C27H43N5O5S — CID 143631994
N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[[1-hydroxy-2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethyl]amino]-N-methylacetamide (PubChem CID 143631994) has the molecular formula C27H43N5O5S and a molecular weight of 549.74 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[[1-hydroxy-2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethyl]amino]-N-methylacetamide.
| Compound Name | N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[[1-hydroxy-2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 143631994 |
| Molecular Formula | C27H43N5O5S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | N-[[4-[2-(dimethylamino)ethyl-methylamino]phenyl]methyl]-2-[[1-hydroxy-2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethyl]amino]-N-methylacetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CC(O)NCC(=O)N(C)Cc2ccc(N(C)CCN(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C27H43N5O5S/c1-20-15-24(37-8)16-21(2)27(20)38(35,36)32(7)19-25(33)28-17-26(34)31(6)18-22-9-11-23(12-10-22)30(5)14-13-29(3)4/h9-12,15-16,25,28,33H,13-14,17-19H2,1-8H3 |
| InChIKey | DJYXCMICOIFGCV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|