About 3-silylpropyl butanoate
3-silylpropyl butanoate (PubChem CID 154457340) has the molecular formula C7H16O2Si
and a molecular weight of 160.29 g/mol. Its IUPAC name is 3-silylpropyl butanoate.
Molecular Properties
| Compound Name | 3-silylpropyl butanoate |
| PubChem CID | 154457340 |
| Molecular Formula | C7H16O2Si |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 3-silylpropyl butanoate |
| SMILES | CCCC(=O)OCCC[SiH3] |
| InChI | InChI=1S/C7H16O2Si/c1-2-4-7(8)9-5-3-6-10/h2-6H2,1,10H3 |
| InChIKey | SDCQLLIBFJSYQI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-silylpropyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-silylpropyl butanoate?
The IUPAC name of 3-silylpropyl butanoate (CID 154457340) is 3-silylpropyl butanoate.
What is the SMILES notation for 3-silylpropyl butanoate?
The canonical SMILES for 3-silylpropyl butanoate is CCCC(=O)OCCC[SiH3].
What is the InChIKey of 3-silylpropyl butanoate?
The InChIKey is SDCQLLIBFJSYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2Si/c1-2-4-7(8)9-5-3-6-10/h2-6H2,1,10H3.
What are the key properties of 3-silylpropyl butanoate?
3-silylpropyl butanoate has a molecular weight of 160.29 g/mol, XLogP of 0.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-silylpropyl butanoate is sourced from PubChem (CID 154457340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).