C22H26N2O4 — CID 67997651
methyl (2S)-2-(benzylideneamino)-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 67997651) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (2S)-2-(benzylideneamino)-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-(benzylideneamino)-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 67997651 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (2S)-2-(benzylideneamino)-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-27-21(25)20(24-16-18-10-4-2-5-11-18)14-8-9-15-23-22(26)28-17-19-12-6-3-7-13-19/h2-7,10-13,16,20H,8-9,14-15,17H2,1H3,(H,23,26)/b24-16+/t20-/m0/s1 |
| InChIKey | DFLGVLSAROKFTL-WEKPXBEKSA-N |
| XLogP | 3.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|