C23H31N3O7Rb2 — CID 58705379
[4-(2,4-dioxopentyl)phenyl]-[3-oxo-3-[2-[3-(propylcarbamoyloxy)propoxy]ethylazanidyl]propanoyl]azanide;bis(rubidium(1+)) (PubChem CID 58705379) has the molecular formula C23H31N3O7Rb2 and a molecular weight of 632.45 g/mol. Its IUPAC name is [4-(2,4-dioxopentyl)phenyl]-[3-oxo-3-[2-[3-(propylcarbamoyloxy)propoxy]ethylazanidyl]propanoyl]azanide;bis(rubidium(1+)).
| Compound Name | [4-(2,4-dioxopentyl)phenyl]-[3-oxo-3-[2-[3-(propylcarbamoyloxy)propoxy]ethylazanidyl]propanoyl]azanide;bis(rubidium(1+)) |
|---|---|
| PubChem CID | 58705379 |
| Molecular Formula | C23H31N3O7Rb2 |
| Molecular Weight | 632.45 g/mol |
| Exact Mass | 631.04 |
| IUPAC Name | [4-(2,4-dioxopentyl)phenyl]-[3-oxo-3-[2-[3-(propylcarbamoyloxy)propoxy]ethylazanidyl]propanoyl]azanide;bis(rubidium(1+)) |
| SMILES | CCCNC(=O)OCCCOCC[N-]C(=O)CC(=O)[N-]c1ccc(CC(=O)CC(C)=O)cc1.[Rb+].[Rb+] |
| InChI | InChI=1S/C23H33N3O7.2Rb/c1-3-9-25-23(31)33-12-4-11-32-13-10-24-21(29)16-22(30)26-19-7-5-18(6-8-19)15-20(28)14-17(2)27;;/h5-8H,3-4,9-16H2,1-2H3,(H3,24,25,26,29,30,31);;/q;2*+1/p-2 |
| InChIKey | LFXRVAMQFVCVLZ-UHFFFAOYSA-L |
| XLogP | -2.85 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.45 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|