C27H40N2O7 — CID 147665309
3-[2-[[4-(2,4-dioxopentyl)phenyl]methyl-methylamino]-2-oxoethoxy]propyl N-(5-methyl-6-oxoheptyl)carbamate (PubChem CID 147665309) has the molecular formula C27H40N2O7 and a molecular weight of 504.62 g/mol. Its IUPAC name is 3-[2-[[4-(2,4-dioxopentyl)phenyl]methyl-methylamino]-2-oxoethoxy]propyl N-(5-methyl-6-oxoheptyl)carbamate.
| Compound Name | 3-[2-[[4-(2,4-dioxopentyl)phenyl]methyl-methylamino]-2-oxoethoxy]propyl N-(5-methyl-6-oxoheptyl)carbamate |
|---|---|
| PubChem CID | 147665309 |
| Molecular Formula | C27H40N2O7 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 3-[2-[[4-(2,4-dioxopentyl)phenyl]methyl-methylamino]-2-oxoethoxy]propyl N-(5-methyl-6-oxoheptyl)carbamate |
| SMILES | CC(=O)CC(=O)Cc1ccc(CN(C)C(=O)COCCCOC(=O)NCCCCC(C)C(C)=O)cc1 |
| InChI | InChI=1S/C27H40N2O7/c1-20(22(3)31)8-5-6-13-28-27(34)36-15-7-14-35-19-26(33)29(4)18-24-11-9-23(10-12-24)17-25(32)16-21(2)30/h9-12,20H,5-8,13-19H2,1-4H3,(H,28,34) |
| InChIKey | GMEIZNOYMUIXLG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|