C16H27N3O3Pd — CID 155698872
N-[4-(aminomethyl)phenyl]-8-oxooctanamide;N-methylhydroxylamine;palladium (PubChem CID 155698872) has the molecular formula C16H27N3O3Pd and a molecular weight of 415.83 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-8-oxooctanamide;N-methylhydroxylamine;palladium.
| Compound Name | N-[4-(aminomethyl)phenyl]-8-oxooctanamide;N-methylhydroxylamine;palladium |
|---|---|
| PubChem CID | 155698872 |
| Molecular Formula | C16H27N3O3Pd |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-8-oxooctanamide;N-methylhydroxylamine;palladium |
| SMILES | CNO.NCc1ccc(NC(=O)CCCCCCC=O)cc1.[Pd] |
| InChI | InChI=1S/C15H22N2O2.CH5NO.Pd/c16-12-13-7-9-14(10-8-13)17-15(19)6-4-2-1-3-5-11-18;1-2-3;/h7-11H,1-6,12,16H2,(H,17,19);2-3H,1H3; |
| InChIKey | CIOHQGUGWSYHEO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|