C18H25F3N4O6 — CID 90118595
[6-[[2-[4-(aminomethyl)anilino]-2-oxoethyl]amino]-6-oxohexyl]carbamic acid;2,2,2-trifluoroacetic acid (PubChem CID 90118595) has the molecular formula C18H25F3N4O6 and a molecular weight of 450.41 g/mol. Its IUPAC name is [6-[[2-[4-(aminomethyl)anilino]-2-oxoethyl]amino]-6-oxohexyl]carbamic acid;2,2,2-trifluoroacetic acid.
| Compound Name | [6-[[2-[4-(aminomethyl)anilino]-2-oxoethyl]amino]-6-oxohexyl]carbamic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90118595 |
| Molecular Formula | C18H25F3N4O6 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [6-[[2-[4-(aminomethyl)anilino]-2-oxoethyl]amino]-6-oxohexyl]carbamic acid;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(NC(=O)CNC(=O)CCCCCNC(=O)O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O4.C2HF3O2/c17-10-12-5-7-13(8-6-12)20-15(22)11-19-14(21)4-2-1-3-9-18-16(23)24;3-2(4,5)1(6)7/h5-8,18H,1-4,9-11,17H2,(H,19,21)(H,20,22)(H,23,24);(H,6,7) |
| InChIKey | ZPMLJZAWZVJSPA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|