C23H37N3O3 — CID 146406468
7-methyl-N-[2-[[2-[4-(2-methylpropyl)anilino]-2-oxoethyl]amino]-2-oxoethyl]octanamide (PubChem CID 146406468) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is 7-methyl-N-[2-[[2-[4-(2-methylpropyl)anilino]-2-oxoethyl]amino]-2-oxoethyl]octanamide.
| Compound Name | 7-methyl-N-[2-[[2-[4-(2-methylpropyl)anilino]-2-oxoethyl]amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 146406468 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 7-methyl-N-[2-[[2-[4-(2-methylpropyl)anilino]-2-oxoethyl]amino]-2-oxoethyl]octanamide |
| SMILES | CC(C)CCCCCC(=O)NCC(=O)NCC(=O)Nc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C23H37N3O3/c1-17(2)8-6-5-7-9-21(27)24-15-22(28)25-16-23(29)26-20-12-10-19(11-13-20)14-18(3)4/h10-13,17-18H,5-9,14-16H2,1-4H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | IVTUFDXURUOQBV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|