C13H28N2O3S2 — CID 139445122
2-[[[2-methyl-1-(propan-2-ylamino)propan-2-yl]disulfanyl]methoxy]ethyl N-ethylcarbamate (PubChem CID 139445122) has the molecular formula C13H28N2O3S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-[[[2-methyl-1-(propan-2-ylamino)propan-2-yl]disulfanyl]methoxy]ethyl N-ethylcarbamate.
| Compound Name | 2-[[[2-methyl-1-(propan-2-ylamino)propan-2-yl]disulfanyl]methoxy]ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 139445122 |
| Molecular Formula | C13H28N2O3S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[[[2-methyl-1-(propan-2-ylamino)propan-2-yl]disulfanyl]methoxy]ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCOCSSC(C)(C)CNC(C)C |
| InChI | InChI=1S/C13H28N2O3S2/c1-6-14-12(16)18-8-7-17-10-19-20-13(4,5)9-15-11(2)3/h11,15H,6-10H2,1-5H3,(H,14,16) |
| InChIKey | YWDCZKFRKHUEQO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|