C18H35BNO3S2 — CID 167558109
CID 167558109 (PubChem CID 167558109) has the molecular formula C18H35BNO3S2 and a molecular weight of 388.43 g/mol.
| Compound Name | CID 167558109 |
|---|---|
| PubChem CID | 167558109 |
| Molecular Formula | C18H35BNO3S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | — |
| SMILES | CC(C)[B]/C=C/CNC(=O)OCCOCSSC(C)(C)CCC(C)C |
| InChI | InChI=1S/C18H35BNO3S2/c1-15(2)8-9-18(5,6)25-24-14-22-12-13-23-17(21)20-11-7-10-19-16(3)4/h7,10,15-16H,8-9,11-14H2,1-6H3,(H,20,21)/b10-7+ |
| InChIKey | WDUGROJDCPFHMG-JXMROGBWSA-N |
| XLogP | 5.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|