About N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate
N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate (PubChem CID 156841701) has the molecular formula C16H35NO4S2
and a molecular weight of 369.59 g/mol. Its IUPAC name is N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate.
Molecular Properties
| Compound Name | N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate |
| PubChem CID | 156841701 |
| Molecular Formula | C16H35NO4S2 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate |
| SMILES | CC(C)OC=O.COCCOCSSC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C12H27NO2S2.C4H8O2/c1-11(2,3)13-9-12(4,5)17-16-10-15-8-7-14-6;1-4(2)6-3-5/h13H,7-10H2,1-6H3;3-4H,1-2H3 |
| InChIKey | VDUUGHHXBBRGQK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate?
The IUPAC name of N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate (CID 156841701) is N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate.
What is the SMILES notation for N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate?
The canonical SMILES for N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate is CC(C)OC=O.COCCOCSSC(C)(C)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate?
The InChIKey is VDUUGHHXBBRGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2S2.C4H8O2/c1-11(2,3)13-9-12(4,5)17-16-10-15-8-7-14-6;1-4(2)6-3-5/h13H,7-10H2,1-6H3;3-4H,1-2H3.
What are the key properties of N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate?
N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate has a molecular weight of 369.59 g/mol, XLogP of 3.72, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(2-methoxyethoxymethyldisulfanyl)-2-methylpropan-1-amine;propan-2-yl formate is sourced from PubChem (CID 156841701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).