C20H37F3N2O5S2 — CID 135257027
4-methyl-4-(2-methylbutoxymethyldisulfanyl)-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 135257027) has the molecular formula C20H37F3N2O5S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-methyl-4-(2-methylbutoxymethyldisulfanyl)-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 4-methyl-4-(2-methylbutoxymethyldisulfanyl)-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 135257027 |
| Molecular Formula | C20H37F3N2O5S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 4-methyl-4-(2-methylbutoxymethyldisulfanyl)-N-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CCC(C)COCSSC(C)(C)CCC(=O)NCCOCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H37F3N2O5S2/c1-5-16(2)14-30-15-31-32-19(3,4)7-6-17(26)24-8-10-28-12-13-29-11-9-25-18(27)20(21,22)23/h16H,5-15H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | GFBIUQDBTLUHJU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|