C22H35N3O4S — CID 155048859
[2-[2-(2-methylpropoxy)ethoxy]-1-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]propan-2-yl] thiocyanate (PubChem CID 155048859) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is [2-[2-(2-methylpropoxy)ethoxy]-1-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]propan-2-yl] thiocyanate.
| Compound Name | [2-[2-(2-methylpropoxy)ethoxy]-1-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]propan-2-yl] thiocyanate |
|---|---|
| PubChem CID | 155048859 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [2-[2-(2-methylpropoxy)ethoxy]-1-[3-[2-(propan-2-ylamino)ethylcarbamoyl]phenoxy]propan-2-yl] thiocyanate |
| SMILES | CC(C)COCCOC(C)(COc1cccc(C(=O)NCCNC(C)C)c1)SC#N |
| InChI | InChI=1S/C22H35N3O4S/c1-17(2)14-27-11-12-29-22(5,30-16-23)15-28-20-8-6-7-19(13-20)21(26)25-10-9-24-18(3)4/h6-8,13,17-18,24H,9-12,14-15H2,1-5H3,(H,25,26) |
| InChIKey | XVSUZEUOLSJYBQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|