C30H54N2O7S3 — CID 167289905
3-[2-(tert-butyldisulfanyl)-2-[2-(methylsulfanylmethoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 167289905) has the molecular formula C30H54N2O7S3 and a molecular weight of 650.97 g/mol. Its IUPAC name is 3-[2-(tert-butyldisulfanyl)-2-[2-(methylsulfanylmethoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(methylsulfanylmethoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 167289905 |
| Molecular Formula | C30H54N2O7S3 |
| Molecular Weight | 650.97 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 3-[2-(tert-butyldisulfanyl)-2-[2-(methylsulfanylmethoxy)ethoxy]propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CSCOCCOC(C)(COc1cccc(C(=O)NCCOCCOCCOCCCNC(C)C)c1)SSC(C)(C)C |
| InChI | InChI=1S/C30H54N2O7S3/c1-25(2)31-12-9-14-34-16-18-36-19-17-35-15-13-32-28(33)26-10-8-11-27(22-26)38-23-30(6,42-41-29(3,4)5)39-21-20-37-24-40-7/h8,10-11,22,25,31H,9,12-21,23-24H2,1-7H3,(H,32,33) |
| InChIKey | SFBZVULSTRKBRP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.97 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|