C23H40N2O5S2 — CID 174104305
3-[(2R)-2-(methyldisulfanyl)propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 174104305) has the molecular formula C23H40N2O5S2 and a molecular weight of 488.72 g/mol. Its IUPAC name is 3-[(2R)-2-(methyldisulfanyl)propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 3-[(2R)-2-(methyldisulfanyl)propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 174104305 |
| Molecular Formula | C23H40N2O5S2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 3-[(2R)-2-(methyldisulfanyl)propoxy]-N-[2-[2-[2-[3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CSS[C@H](C)COc1cccc(C(=O)NCCOCCOCCOCCCNC(C)C)c1 |
| InChI | InChI=1S/C23H40N2O5S2/c1-19(2)24-9-6-11-27-13-15-29-16-14-28-12-10-25-23(26)21-7-5-8-22(17-21)30-18-20(3)32-31-4/h5,7-8,17,19-20,24H,6,9-16,18H2,1-4H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | XYNBEEZUWZIFTD-HXUWFJFHSA-N |
| XLogP | 3.63 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|