C28H49N3O4 — CID 178152028
3-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]-N-[2,4,4-trimethyl-5-(methylamino)pentan-2-yl]benzamide;ethane (PubChem CID 178152028) has the molecular formula C28H49N3O4 and a molecular weight of 491.72 g/mol. Its IUPAC name is 3-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]-N-[2,4,4-trimethyl-5-(methylamino)pentan-2-yl]benzamide;ethane.
| Compound Name | 3-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]-N-[2,4,4-trimethyl-5-(methylamino)pentan-2-yl]benzamide;ethane |
|---|---|
| PubChem CID | 178152028 |
| Molecular Formula | C28H49N3O4 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.37 |
| IUPAC Name | 3-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]-N-[2,4,4-trimethyl-5-(methylamino)pentan-2-yl]benzamide;ethane |
| SMILES | CC.CC.CC#CCNC(=O)COCCOc1cccc(C(=O)NC(C)(C)CC(C)(C)CNC)c1 |
| InChI | InChI=1S/C24H37N3O4.2C2H6/c1-7-8-12-26-21(28)16-30-13-14-31-20-11-9-10-19(15-20)22(29)27-24(4,5)17-23(2,3)18-25-6;2*1-2/h9-11,15,25H,12-14,16-18H2,1-6H3,(H,26,28)(H,27,29);2*1-2H3 |
| InChIKey | VJXPMHUWPJWRHY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|