C20H26N2O3 — CID 10854797
ethyl 4-[3-(4-aminobenzoyl)-4-propan-2-ylpyrrol-1-yl]butanoate (PubChem CID 10854797) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl 4-[3-(4-aminobenzoyl)-4-propan-2-ylpyrrol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-(4-aminobenzoyl)-4-propan-2-ylpyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 10854797 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl 4-[3-(4-aminobenzoyl)-4-propan-2-ylpyrrol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2ccc(N)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-4-25-19(23)6-5-11-22-12-17(14(2)3)18(13-22)20(24)15-7-9-16(21)10-8-15/h7-10,12-14H,4-6,11,21H2,1-3H3 |
| InChIKey | ASYQBDIKMLHWBV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|