C34H44N2O5 — CID 139750268
benzyl 7-[3-[5-(4-ethoxy-4-oxobutyl)-2-ethyl-1-methylpyrrole-3-carbonyl]anilino]heptanoate (PubChem CID 139750268) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is benzyl 7-[3-[5-(4-ethoxy-4-oxobutyl)-2-ethyl-1-methylpyrrole-3-carbonyl]anilino]heptanoate.
| Compound Name | benzyl 7-[3-[5-(4-ethoxy-4-oxobutyl)-2-ethyl-1-methylpyrrole-3-carbonyl]anilino]heptanoate |
|---|---|
| PubChem CID | 139750268 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | benzyl 7-[3-[5-(4-ethoxy-4-oxobutyl)-2-ethyl-1-methylpyrrole-3-carbonyl]anilino]heptanoate |
| SMILES | CCOC(=O)CCCc1cc(C(=O)c2cccc(NCCCCCCC(=O)OCc3ccccc3)c2)c(CC)n1C |
| InChI | InChI=1S/C34H44N2O5/c1-4-31-30(24-29(36(31)3)19-14-21-32(37)40-5-2)34(39)27-17-13-18-28(23-27)35-22-12-7-6-11-20-33(38)41-25-26-15-9-8-10-16-26/h8-10,13,15-18,23-24,35H,4-7,11-12,14,19-22,25H2,1-3H3 |
| InChIKey | FAEYGYYEGWFDBC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|