C34H48N2O5 — CID 140995415
4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-[[2-[(4-hydroxyphenyl)methoxy]acetyl]-octylamino]benzoic acid (PubChem CID 140995415) has the molecular formula C34H48N2O5 and a molecular weight of 564.77 g/mol. Its IUPAC name is 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-[[2-[(4-hydroxyphenyl)methoxy]acetyl]-octylamino]benzoic acid.
| Compound Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-[[2-[(4-hydroxyphenyl)methoxy]acetyl]-octylamino]benzoic acid |
|---|---|
| PubChem CID | 140995415 |
| Molecular Formula | C34H48N2O5 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-[[2-[(4-hydroxyphenyl)methoxy]acetyl]-octylamino]benzoic acid |
| SMILES | CCCCCCCCN(C(=O)COCc1ccc(O)cc1)c1cc(NC/C=C(\C)CCC=C(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C34H48N2O5/c1-5-6-7-8-9-10-22-36(33(38)25-41-24-28-14-17-30(37)18-15-28)32-23-29(16-19-31(32)34(39)40)35-21-20-27(4)13-11-12-26(2)3/h12,14-20,23,35,37H,5-11,13,21-22,24-25H2,1-4H3,(H,39,40)/b27-20+ |
| InChIKey | QZIYBTFNGBZPFX-NHFJDJAPSA-N |
| XLogP | 8.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|