C28H44O2 — CID 121429598
1-(3,5-ditert-butyl-4-methylphenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one (PubChem CID 121429598) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-methylphenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one.
| Compound Name | 1-(3,5-ditert-butyl-4-methylphenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one |
|---|---|
| PubChem CID | 121429598 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-methylphenyl)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one |
| SMILES | CC(C)=CCC/C(C)=C/COC(C)C(=O)c1cc(C(C)(C)C)c(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H44O2/c1-19(2)13-12-14-20(3)15-16-30-22(5)26(29)23-17-24(27(6,7)8)21(4)25(18-23)28(9,10)11/h13,15,17-18,22H,12,14,16H2,1-11H3/b20-15+ |
| InChIKey | QSNUXCJAPSHJOS-HMMYKYKNSA-N |
| XLogP | 7.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|