C43H57NO5 — CID 59602875
(3S)-3-benzamido-2-[(12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]oxy-3-phenylpropanoic acid (PubChem CID 59602875) has the molecular formula C43H57NO5 and a molecular weight of 667.93 g/mol. Its IUPAC name is (3S)-3-benzamido-2-[(12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]oxy-3-phenylpropanoic acid.
| Compound Name | (3S)-3-benzamido-2-[(12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 59602875 |
| Molecular Formula | C43H57NO5 |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.42 |
| IUPAC Name | (3S)-3-benzamido-2-[(12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]oxy-3-phenylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC=C(C)CCC=C(C)CCC(=O)OC(C(=O)O)[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H57NO5/c1-32(2)18-15-21-35(5)24-16-22-33(3)19-13-14-20-34(4)23-17-25-36(6)30-31-39(45)49-41(43(47)48)40(37-26-9-7-10-27-37)44-42(46)38-28-11-8-12-29-38/h7-12,18-20,24-29,40-41H,13-17,21-23,30-31H2,1-6H3,(H,44,46)(H,47,48)/b33-19+,34-20?,35-24+,36-25?/t40-,41?/m0/s1 |
| InChIKey | HFCCRDQPURGAFE-ZQXZCVDHSA-N |
| XLogP | 10.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|