C11H18O — CID 11446544
2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]oxirane (PubChem CID 11446544) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]oxirane.
| Compound Name | 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]oxirane |
|---|---|
| PubChem CID | 11446544 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C\C1CO1 |
| InChI | InChI=1S/C11H18O/c1-9(2)5-4-6-10(3)7-11-8-12-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
| InChIKey | CVLUQCFBBAQDOH-YFHOEESVSA-N |
| XLogP | 3.08 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|