C16H32O9Si2 — CID 71331307
bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate (PubChem CID 71331307) has the molecular formula C16H32O9Si2 and a molecular weight of 424.60 g/mol. Its IUPAC name is bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate.
| Compound Name | bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71331307 |
| Molecular Formula | C16H32O9Si2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate |
| SMILES | COC(OC)[SiH2]CCCOC(=O)C1OC1C(=O)OCCC[SiH2]C(OC)OC |
| InChI | InChI=1S/C16H32O9Si2/c1-19-15(20-2)26-9-5-7-23-13(17)11-12(25-11)14(18)24-8-6-10-27-16(21-3)22-4/h11-12,15-16H,5-10,26-27H2,1-4H3 |
| InChIKey | BHFJYZMCHQAVDI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|