About bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate
bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate (PubChem CID 71331307) has the molecular formula C16H32O9Si2
and a molecular weight of 424.60 g/mol. Its IUPAC name is bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate |
| PubChem CID | 71331307 |
| Molecular Formula | C16H32O9Si2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate |
| SMILES | COC(OC)[SiH2]CCCOC(=O)C1OC1C(=O)OCCC[SiH2]C(OC)OC |
| InChI | InChI=1S/C16H32O9Si2/c1-19-15(20-2)26-9-5-7-23-13(17)11-12(25-11)14(18)24-8-6-10-27-16(21-3)22-4/h11-12,15-16H,5-10,26-27H2,1-4H3 |
| InChIKey | BHFJYZMCHQAVDI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate?
The IUPAC name of bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate (CID 71331307) is bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate.
What is the SMILES notation for bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate?
The canonical SMILES for bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate is COC(OC)[SiH2]CCCOC(=O)C1OC1C(=O)OCCC[SiH2]C(OC)OC.
What is the InChIKey of bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate?
The InChIKey is BHFJYZMCHQAVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O9Si2/c1-19-15(20-2)26-9-5-7-23-13(17)11-12(25-11)14(18)24-8-6-10-27-16(21-3)22-4/h11-12,15-16H,5-10,26-27H2,1-4H3.
What are the key properties of bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate?
bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate has a molecular weight of 424.60 g/mol, XLogP of -1.05, 16 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(dimethoxymethylsilyl)propyl] oxirane-2,3-dicarboxylate is sourced from PubChem (CID 71331307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).