C25H40O11S5 — CID 129159661
pentakis(3-sulfanylpropyl) oxane-2,3,4,5,6-pentacarboxylate (PubChem CID 129159661) has the molecular formula C25H40O11S5 and a molecular weight of 676.92 g/mol. Its IUPAC name is pentakis(3-sulfanylpropyl) oxane-2,3,4,5,6-pentacarboxylate.
| Compound Name | pentakis(3-sulfanylpropyl) oxane-2,3,4,5,6-pentacarboxylate |
|---|---|
| PubChem CID | 129159661 |
| Molecular Formula | C25H40O11S5 |
| Molecular Weight | 676.92 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | pentakis(3-sulfanylpropyl) oxane-2,3,4,5,6-pentacarboxylate |
| SMILES | O=C(OCCCS)C1OC(C(=O)OCCCS)C(C(=O)OCCCS)C(C(=O)OCCCS)C1C(=O)OCCCS |
| InChI | InChI=1S/C25H40O11S5/c26-21(31-6-1-11-37)16-17(22(27)32-7-2-12-38)19(24(29)34-9-4-14-40)36-20(25(30)35-10-5-15-41)18(16)23(28)33-8-3-13-39/h16-20,37-41H,1-15H2 |
| InChIKey | YPTPRVJKDACMFB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.92 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|