C12H17NO5 — CID 153439310
4-(2-azaniumylethoxycarbonyl)-2,5-bis(ethenyl)oxolane-3-carboxylate (PubChem CID 153439310) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(2-azaniumylethoxycarbonyl)-2,5-bis(ethenyl)oxolane-3-carboxylate.
| Compound Name | 4-(2-azaniumylethoxycarbonyl)-2,5-bis(ethenyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 153439310 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-(2-azaniumylethoxycarbonyl)-2,5-bis(ethenyl)oxolane-3-carboxylate |
| SMILES | C=CC1OC(C=C)C(C(=O)OCC[NH3+])C1C(=O)[O-] |
| InChI | InChI=1S/C12H17NO5/c1-3-7-9(11(14)15)10(8(4-2)18-7)12(16)17-6-5-13/h3-4,7-10H,1-2,5-6,13H2,(H,14,15) |
| InChIKey | UUWVTEZUOZIVRK-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|