About 2-aminoethylazanium;prop-2-enoate
2-aminoethylazanium;prop-2-enoate (PubChem CID 118678416) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-aminoethylazanium;prop-2-enoate.
Molecular Properties
| Compound Name | 2-aminoethylazanium;prop-2-enoate |
| PubChem CID | 118678416 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2-aminoethylazanium;prop-2-enoate |
| SMILES | C=CC(=O)[O-].NCC[NH3+] |
| InChI | InChI=1S/C3H4O2.C2H8N2/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);1-4H2 |
| InChIKey | XAQAETYSIZOJIJ-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethylazanium;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylazanium;prop-2-enoate?
The IUPAC name of 2-aminoethylazanium;prop-2-enoate (CID 118678416) is 2-aminoethylazanium;prop-2-enoate.
What is the SMILES notation for 2-aminoethylazanium;prop-2-enoate?
The canonical SMILES for 2-aminoethylazanium;prop-2-enoate is C=CC(=O)[O-].NCC[NH3+].
What is the InChIKey of 2-aminoethylazanium;prop-2-enoate?
The InChIKey is XAQAETYSIZOJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H8N2/c1-2-3(4)5;3-1-2-4/h2H,1H2,(H,4,5);1-4H2.
What are the key properties of 2-aminoethylazanium;prop-2-enoate?
2-aminoethylazanium;prop-2-enoate has a molecular weight of 132.16 g/mol, XLogP of -2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylazanium;prop-2-enoate is sourced from PubChem (CID 118678416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).