About 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate
3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate (PubChem CID 88736239) has the molecular formula C24H41NO4
and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate.
Molecular Properties
| Compound Name | 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate |
| PubChem CID | 88736239 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate |
| SMILES | CCCC/N=C(/OCCCC1CCCC1)C1OC1C(=O)OCCCC1CCCC1 |
| InChI | InChI=1S/C24H41NO4/c1-2-3-16-25-23(27-17-8-14-19-10-4-5-11-19)21-22(29-21)24(26)28-18-9-15-20-12-6-7-13-20/h19-22H,2-18H2,1H3/b25-23+ |
| InChIKey | HMAMLQSZOUXBHD-WJTDDFOZSA-N |
| XLogP | 5.45 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate?
The IUPAC name of 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate (CID 88736239) is 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate.
What is the SMILES notation for 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate?
The canonical SMILES for 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate is CCCC/N=C(/OCCCC1CCCC1)C1OC1C(=O)OCCCC1CCCC1.
What is the InChIKey of 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate?
The InChIKey is HMAMLQSZOUXBHD-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H41NO4/c1-2-3-16-25-23(27-17-8-14-19-10-4-5-11-19)21-22(29-21)24(26)28-18-9-15-20-12-6-7-13-20/h19-22H,2-18H2,1H3/b25-23+.
What are the key properties of 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate?
3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate has a molecular weight of 407.60 g/mol, XLogP of 5.45, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropyl 3-[N-butyl-C-(3-cyclopentylpropoxy)carbonimidoyl]oxirane-2-carboxylate is sourced from PubChem (CID 88736239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).