C16H32O4Si3 — CID 154059943
3-[bis[[ethenyl(dimethyl)silyl]oxy]methylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 154059943) has the molecular formula C16H32O4Si3 and a molecular weight of 372.69 g/mol. Its IUPAC name is 3-[bis[[ethenyl(dimethyl)silyl]oxy]methylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[bis[[ethenyl(dimethyl)silyl]oxy]methylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154059943 |
| Molecular Formula | C16H32O4Si3 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-[bis[[ethenyl(dimethyl)silyl]oxy]methylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C[Si](C)(C)OC(O[Si](C)(C)C=C)[SiH2]CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C16H32O4Si3/c1-9-22(5,6)19-16(20-23(7,8)10-2)21-13-11-12-18-15(17)14(3)4/h9-10,16H,1-3,11-13,21H2,4-8H3 |
| InChIKey | CGLJGUWVVOZDCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|