C20H32O6 — CID 18006649
1,4-bis(ethenoxy)butane;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (PubChem CID 18006649) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1,4-bis(ethenoxy)butane;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
| Compound Name | 1,4-bis(ethenoxy)butane;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18006649 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1,4-bis(ethenoxy)butane;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)C(=C)C.C=COCCCCOC=C |
| InChI | InChI=1S/C12H18O4.C8H14O2/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4;1-3-9-7-5-6-8-10-4-2/h1,3,5-8H2,2,4H3;3-4H,1-2,5-8H2 |
| InChIKey | PHHSWLIQBKZESK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|