C21H16 — CID 157251176
10-methyl-10,12-dihydroindeno[2,1-b]fluorene (PubChem CID 157251176) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is 10-methyl-10,12-dihydroindeno[2,1-b]fluorene.
| Compound Name | 10-methyl-10,12-dihydroindeno[2,1-b]fluorene |
|---|---|
| PubChem CID | 157251176 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 10-methyl-10,12-dihydroindeno[2,1-b]fluorene |
| SMILES | CC1c2ccccc2-c2cc3c(cc21)Cc1ccccc1-3 |
| InChI | InChI=1S/C21H16/c1-13-16-7-4-5-9-18(16)21-12-20-15(11-19(13)21)10-14-6-2-3-8-17(14)20/h2-9,11-13H,10H2,1H3 |
| InChIKey | PNDCFRHOUHTQAQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |