C18H23N2+ — CID 140881322
5-(1-deuteriocyclohexyl)-1-methyl-6-(2-methylphenyl)pyrimidin-1-ium (PubChem CID 140881322) has the molecular formula C18H23N2+ and a molecular weight of 268.40 g/mol. Its IUPAC name is 5-(1-deuteriocyclohexyl)-1-methyl-6-(2-methylphenyl)pyrimidin-1-ium.
| Compound Name | 5-(1-deuteriocyclohexyl)-1-methyl-6-(2-methylphenyl)pyrimidin-1-ium |
|---|---|
| PubChem CID | 140881322 |
| Molecular Formula | C18H23N2+ |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 5-(1-deuteriocyclohexyl)-1-methyl-6-(2-methylphenyl)pyrimidin-1-ium |
| SMILES | [2H]C1(c2cnc[n+](C)c2-c2ccccc2C)CCCCC1 |
| InChI | InChI=1S/C18H23N2/c1-14-8-6-7-11-16(14)18-17(12-19-13-20(18)2)15-9-4-3-5-10-15/h6-8,11-13,15H,3-5,9-10H2,1-2H3/q+1/i15D |
| InChIKey | VHONOBOTDABZJQ-RWFJLFJASA-N |
| XLogP | 3.93 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|