C15H14N3+ — CID 123952026
3-methyl-4-(2-methylphenyl)pyrido[3,2-d]pyrimidin-3-ium (PubChem CID 123952026) has the molecular formula C15H14N3+ and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-methyl-4-(2-methylphenyl)pyrido[3,2-d]pyrimidin-3-ium.
| Compound Name | 3-methyl-4-(2-methylphenyl)pyrido[3,2-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 123952026 |
| Molecular Formula | C15H14N3+ |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-methyl-4-(2-methylphenyl)pyrido[3,2-d]pyrimidin-3-ium |
| SMILES | Cc1ccccc1-c1c2ncccc2nc[n+]1C |
| InChI | InChI=1S/C15H14N3/c1-11-6-3-4-7-12(11)15-14-13(8-5-9-16-14)17-10-18(15)2/h3-10H,1-2H3/q+1 |
| InChIKey | NESLFENYZNYESG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|