C18H15BN2Y+ — CID 169301180
CID 169301180 (PubChem CID 169301180) has the molecular formula C18H15BN2Y+ and a molecular weight of 359.05 g/mol.
| Compound Name | CID 169301180 |
|---|---|
| PubChem CID | 169301180 |
| Molecular Formula | C18H15BN2Y+ |
| Molecular Weight | 359.05 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | — |
| SMILES | CC1=C(c2c3ccccc3nc[n+]2C)[B]c2ccccc21.[Y] |
| InChI | InChI=1S/C18H15BN2.Y/c1-12-13-7-3-5-9-15(13)19-17(12)18-14-8-4-6-10-16(14)20-11-21(18)2;/h3-11H,1-2H3;/q+1; |
| InChIKey | VIKBDPRNKMMQSV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.05 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|