C24H18N3O+ — CID 170251676
7,8-dimethyl-6-(3-methylquinazolin-3-ium-4-yl)dibenzofuran-3-carbonitrile (PubChem CID 170251676) has the molecular formula C24H18N3O+ and a molecular weight of 364.43 g/mol. Its IUPAC name is 7,8-dimethyl-6-(3-methylquinazolin-3-ium-4-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 7,8-dimethyl-6-(3-methylquinazolin-3-ium-4-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 170251676 |
| Molecular Formula | C24H18N3O+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 7,8-dimethyl-6-(3-methylquinazolin-3-ium-4-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1cc2c(oc3cc(C#N)ccc32)c(-c2c3ccccc3nc[n+]2C)c1C |
| InChI | InChI=1S/C24H18N3O/c1-14-10-19-17-9-8-16(12-25)11-21(17)28-24(19)22(15(14)2)23-18-6-4-5-7-20(18)26-13-27(23)3/h4-11,13H,1-3H3/q+1 |
| InChIKey | PQSYSKWERXRRAS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|