C22H15F2N2O+ — CID 152818349
4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methylquinazolin-3-ium (PubChem CID 152818349) has the molecular formula C22H15F2N2O+ and a molecular weight of 361.37 g/mol. Its IUPAC name is 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methylquinazolin-3-ium.
| Compound Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methylquinazolin-3-ium |
|---|---|
| PubChem CID | 152818349 |
| Molecular Formula | C22H15F2N2O+ |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-3-methylquinazolin-3-ium |
| SMILES | Cc1ccc2c(oc3cc(F)cc(F)c32)c1-c1c2ccccc2nc[n+]1C |
| InChI | InChI=1S/C22H15F2N2O/c1-12-7-8-15-20-16(24)9-13(23)10-18(20)27-22(15)19(12)21-14-5-3-4-6-17(14)25-11-26(21)2/h3-11H,1-2H3/q+1 |
| InChIKey | GDJWVGDWQZTUMN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|