C27H25F2N2O+ — CID 153464465
4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium (PubChem CID 153464465) has the molecular formula C27H25F2N2O+ and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium.
| Compound Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium |
|---|---|
| PubChem CID | 153464465 |
| Molecular Formula | C27H25F2N2O+ |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-(7,9-difluoro-3-methyldibenzofuran-4-yl)-7-(2,2-dimethylpropyl)-3-methylquinazolin-3-ium |
| SMILES | Cc1ccc2c(oc3cc(F)cc(F)c32)c1-c1c2ccc(CC(C)(C)C)cc2nc[n+]1C |
| InChI | InChI=1S/C27H25F2N2O/c1-15-6-8-19-24-20(29)11-17(28)12-22(24)32-26(19)23(15)25-18-9-7-16(13-27(2,3)4)10-21(18)30-14-31(25)5/h6-12,14H,13H2,1-5H3/q+1 |
| InChIKey | KJQPOGGJHXOJCO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|