C18H22N3+ — CID 169277780
1-cyclopentyl-N-[1-methyl-6-(2-methylphenyl)pyrimidin-1-ium-5-yl]methanimine (PubChem CID 169277780) has the molecular formula C18H22N3+ and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-cyclopentyl-N-[1-methyl-6-(2-methylphenyl)pyrimidin-1-ium-5-yl]methanimine.
| Compound Name | 1-cyclopentyl-N-[1-methyl-6-(2-methylphenyl)pyrimidin-1-ium-5-yl]methanimine |
|---|---|
| PubChem CID | 169277780 |
| Molecular Formula | C18H22N3+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-cyclopentyl-N-[1-methyl-6-(2-methylphenyl)pyrimidin-1-ium-5-yl]methanimine |
| SMILES | Cc1ccccc1-c1c(/N=C/C2CCCC2)cnc[n+]1C |
| InChI | InChI=1S/C18H22N3/c1-14-7-3-6-10-16(14)18-17(12-19-13-21(18)2)20-11-15-8-4-5-9-15/h3,6-7,10-13,15H,4-5,8-9H2,1-2H3/q+1/b20-11+ |
| InChIKey | SXOQMIJZUMLZIV-RGVLZGJSSA-N |
| XLogP | 3.77 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|