C19H22N3Y- — CID 169277675
1-cyclohexyl-N-[1-methyl-6-(2-methylphenyl)-4H-pyridazin-1-ium-4-id-5-yl]methanimine;yttrium (PubChem CID 169277675) has the molecular formula C19H22N3Y- and a molecular weight of 381.31 g/mol. Its IUPAC name is 1-cyclohexyl-N-[1-methyl-6-(2-methylphenyl)-4H-pyridazin-1-ium-4-id-5-yl]methanimine;yttrium.
| Compound Name | 1-cyclohexyl-N-[1-methyl-6-(2-methylphenyl)-4H-pyridazin-1-ium-4-id-5-yl]methanimine;yttrium |
|---|---|
| PubChem CID | 169277675 |
| Molecular Formula | C19H22N3Y- |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-cyclohexyl-N-[1-methyl-6-(2-methylphenyl)-4H-pyridazin-1-ium-4-id-5-yl]methanimine;yttrium |
| SMILES | Cc1ccccc1-c1c(/N=[C-]/C2CCCCC2)[c-]cn[n+]1C.[Y] |
| InChI | InChI=1S/C19H22N3.Y/c1-15-8-6-7-11-17(15)19-18(12-13-21-22(19)2)20-14-16-9-4-3-5-10-16;/h6-8,11,13,16H,3-5,9-10H2,1-2H3;/q-1; |
| InChIKey | IMMPXWPLBHEIRE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|