C15H19N3O — CID 119027868
N-cyclohexyl-3-(2-methylphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 119027868) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-cyclohexyl-3-(2-methylphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-cyclohexyl-3-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 119027868 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-cyclohexyl-3-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | Cc1ccccc1-c1noc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H19N3O/c1-11-7-5-6-10-13(11)14-17-15(19-18-14)16-12-8-3-2-4-9-12/h5-7,10,12H,2-4,8-9H2,1H3,(H,16,17,18) |
| InChIKey | GMNIHNQHBAZMLY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |