C17H23N3O3 — CID 46342176
N-cycloheptyl-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 46342176) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-cycloheptyl-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-cycloheptyl-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 46342176 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-cycloheptyl-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COc1cccc(-c2noc(NC3CCCCCC3)n2)c1OC |
| InChI | InChI=1S/C17H23N3O3/c1-21-14-11-7-10-13(15(14)22-2)16-19-17(23-20-16)18-12-8-5-3-4-6-9-12/h7,10-12H,3-6,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | MOSUIWYYGWEMDM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |