C13H12N3Y- — CID 164937480
N-[1-methyl-6-(2-methylphenyl)-4H-pyrimidin-1-ium-4-id-5-yl]methanimine;yttrium (PubChem CID 164937480) has the molecular formula C13H12N3Y- and a molecular weight of 299.17 g/mol. Its IUPAC name is N-[1-methyl-6-(2-methylphenyl)-4H-pyrimidin-1-ium-4-id-5-yl]methanimine;yttrium.
| Compound Name | N-[1-methyl-6-(2-methylphenyl)-4H-pyrimidin-1-ium-4-id-5-yl]methanimine;yttrium |
|---|---|
| PubChem CID | 164937480 |
| Molecular Formula | C13H12N3Y- |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | N-[1-methyl-6-(2-methylphenyl)-4H-pyrimidin-1-ium-4-id-5-yl]methanimine;yttrium |
| SMILES | [H]/[C-]=N/c1[c-]nc[n+](C)c1-c1ccccc1C.[Y] |
| InChI | InChI=1S/C13H12N3.Y/c1-10-6-4-5-7-11(10)13-12(14-2)8-15-9-16(13)3;/h2,4-7,9H,1,3H3;/q-1; |
| InChIKey | AMCYXVWIXNVXHY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|