C28H25N2O+ — CID 166050938
6-deuterio-6-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-7,8-dihydro-5H-isoquinoline (PubChem CID 166050938) has the molecular formula C28H25N2O+ and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-deuterio-6-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-7,8-dihydro-5H-isoquinoline.
| Compound Name | 6-deuterio-6-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-7,8-dihydro-5H-isoquinoline |
|---|---|
| PubChem CID | 166050938 |
| Molecular Formula | C28H25N2O+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 6-deuterio-6-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-7,8-dihydro-5H-isoquinoline |
| SMILES | [2H]C1(c2cccc3c2oc2c(-c4cccc[n+]4C)c(C)ccc23)CCc2cnccc2C1 |
| InChI | InChI=1S/C28H25N2O/c1-18-9-12-24-23-7-5-6-22(20-10-11-21-17-29-14-13-19(21)16-20)27(23)31-28(24)26(18)25-8-3-4-15-30(25)2/h3-9,12-15,17,20H,10-11,16H2,1-2H3/q+1/i20D |
| InChIKey | QYOADTDHHXGDPT-YVHRXSIGSA-N |
| XLogP | 6.05 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|