C18H18N+ — CID 162269712
5-methyl-4-(2-methylphenyl)-1a,7b-dihydro-1H-cyclopropa[f]isoquinolin-5-ium (PubChem CID 162269712) has the molecular formula C18H18N+ and a molecular weight of 248.35 g/mol. Its IUPAC name is 5-methyl-4-(2-methylphenyl)-1a,7b-dihydro-1H-cyclopropa[f]isoquinolin-5-ium.
| Compound Name | 5-methyl-4-(2-methylphenyl)-1a,7b-dihydro-1H-cyclopropa[f]isoquinolin-5-ium |
|---|---|
| PubChem CID | 162269712 |
| Molecular Formula | C18H18N+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-methyl-4-(2-methylphenyl)-1a,7b-dihydro-1H-cyclopropa[f]isoquinolin-5-ium |
| SMILES | Cc1ccccc1-c1c2c(cc[n+]1C)C1CC1C=C2 |
| InChI | InChI=1S/C18H18N/c1-12-5-3-4-6-14(12)18-16-8-7-13-11-17(13)15(16)9-10-19(18)2/h3-10,13,17H,11H2,1-2H3/q+1 |
| InChIKey | ZMMPJZICEVPSIW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|