C18H22N+ — CID 140737126
5,5,8,8-tetradeuterio-2-methyl-1-[2-methyl-4-(trideuteriomethyl)phenyl]-6,7-dihydroisoquinolin-2-ium (PubChem CID 140737126) has the molecular formula C18H22N+ and a molecular weight of 259.42 g/mol. Its IUPAC name is 5,5,8,8-tetradeuterio-2-methyl-1-[2-methyl-4-(trideuteriomethyl)phenyl]-6,7-dihydroisoquinolin-2-ium.
| Compound Name | 5,5,8,8-tetradeuterio-2-methyl-1-[2-methyl-4-(trideuteriomethyl)phenyl]-6,7-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 140737126 |
| Molecular Formula | C18H22N+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | 5,5,8,8-tetradeuterio-2-methyl-1-[2-methyl-4-(trideuteriomethyl)phenyl]-6,7-dihydroisoquinolin-2-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c3c(cc[n+]2C)C([2H])([2H])CCC3([2H])[2H])c(C)c1 |
| InChI | InChI=1S/C18H22N/c1-13-8-9-16(14(2)12-13)18-17-7-5-4-6-15(17)10-11-19(18)3/h8-12H,4-7H2,1-3H3/q+1/i1D3,6D2,7D2 |
| InChIKey | ALXXIVGBZKPEHH-DDROHRSCSA-N |
| XLogP | 3.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|