C22H30N+ — CID 176617904
4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 176617904) has the molecular formula C22H30N+ and a molecular weight of 312.51 g/mol. Its IUPAC name is 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 176617904 |
| Molecular Formula | C22H30N+ |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-[2-methyl-4-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc(C3([2H])CCC(C)(C)CC3)cc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C22H30N/c1-16-6-7-20(17(2)14-16)21-15-19(10-13-23(21)5)18-8-11-22(3,4)12-9-18/h6-7,10,13-15,18H,8-9,11-12H2,1-5H3/q+1/i1D3,18D |
| InChIKey | JKNBITMLPXLBDB-MAOWXWBLSA-N |
| XLogP | 5.48 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|