C17H14NO2+ — CID 164756828
3-methyl-2-(2-methylphenyl)-[1]benzofuro[2,3-d][1,3]oxazol-3-ium (PubChem CID 164756828) has the molecular formula C17H14NO2+ and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-methyl-2-(2-methylphenyl)-[1]benzofuro[2,3-d][1,3]oxazol-3-ium.
| Compound Name | 3-methyl-2-(2-methylphenyl)-[1]benzofuro[2,3-d][1,3]oxazol-3-ium |
|---|---|
| PubChem CID | 164756828 |
| Molecular Formula | C17H14NO2+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-methyl-2-(2-methylphenyl)-[1]benzofuro[2,3-d][1,3]oxazol-3-ium |
| SMILES | Cc1ccccc1-c1oc2c3ccccc3oc2[n+]1C |
| InChI | InChI=1S/C17H14NO2/c1-11-7-3-4-8-12(11)16-18(2)17-15(20-16)13-9-5-6-10-14(13)19-17/h3-10H,1-2H3/q+1 |
| InChIKey | CJGREBCKXLTNLN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|