C26H17N2O2+ — CID 176767756
6-methyl-5-(2-methylphenyl)-4,11-dioxa-6-azoniapentacyclo[10.8.0.02,10.03,7.014,19]icosa-1(20),2(10),3(7),5,8,12,14,16,18-nonaene-9-carbonitrile (PubChem CID 176767756) has the molecular formula C26H17N2O2+ and a molecular weight of 389.43 g/mol. Its IUPAC name is 6-methyl-5-(2-methylphenyl)-4,11-dioxa-6-azoniapentacyclo[10.8.0.02,10.03,7.014,19]icosa-1(20),2(10),3(7),5,8,12,14,16,18-nonaene-9-carbonitrile.
| Compound Name | 6-methyl-5-(2-methylphenyl)-4,11-dioxa-6-azoniapentacyclo[10.8.0.02,10.03,7.014,19]icosa-1(20),2(10),3(7),5,8,12,14,16,18-nonaene-9-carbonitrile |
|---|---|
| PubChem CID | 176767756 |
| Molecular Formula | C26H17N2O2+ |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 6-methyl-5-(2-methylphenyl)-4,11-dioxa-6-azoniapentacyclo[10.8.0.02,10.03,7.014,19]icosa-1(20),2(10),3(7),5,8,12,14,16,18-nonaene-9-carbonitrile |
| SMILES | Cc1ccccc1-c1oc2c3c(oc4cc5ccccc5cc43)c(C#N)cc2[n+]1C |
| InChI | InChI=1S/C26H17N2O2/c1-15-7-3-6-10-19(15)26-28(2)21-12-18(14-27)24-23(25(21)30-26)20-11-16-8-4-5-9-17(16)13-22(20)29-24/h3-13H,1-2H3/q+1 |
| InChIKey | HJWFFXPCKKTBNN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 53.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|