C31H26GeNO+ — CID 177124578
6,22,22-trimethyl-5-(2-methylphenyl)-4-oxa-6-azonia-22-germahexacyclo[11.11.0.02,10.03,7.015,23.016,21]tetracosa-1(24),2(10),3(7),5,8,11,13,15(23),16,18,20-undecaene (PubChem CID 177124578) has the molecular formula C31H26GeNO+ and a molecular weight of 501.17 g/mol. Its IUPAC name is 6,22,22-trimethyl-5-(2-methylphenyl)-4-oxa-6-azonia-22-germahexacyclo[11.11.0.02,10.03,7.015,23.016,21]tetracosa-1(24),2(10),3(7),5,8,11,13,15(23),16,18,20-undecaene.
| Compound Name | 6,22,22-trimethyl-5-(2-methylphenyl)-4-oxa-6-azonia-22-germahexacyclo[11.11.0.02,10.03,7.015,23.016,21]tetracosa-1(24),2(10),3(7),5,8,11,13,15(23),16,18,20-undecaene |
|---|---|
| PubChem CID | 177124578 |
| Molecular Formula | C31H26GeNO+ |
| Molecular Weight | 501.17 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 6,22,22-trimethyl-5-(2-methylphenyl)-4-oxa-6-azonia-22-germahexacyclo[11.11.0.02,10.03,7.015,23.016,21]tetracosa-1(24),2(10),3(7),5,8,11,13,15(23),16,18,20-undecaene |
| SMILES | Cc1ccccc1-c1oc2c3c(ccc4cc5c(cc43)[Ge](C)(C)c3ccccc3-5)ccc2[n+]1C |
| InChI | InChI=1S/C31H26GeNO/c1-19-9-5-6-10-22(19)31-33(4)28-16-15-20-13-14-21-17-25-23-11-7-8-12-26(23)32(2,3)27(25)18-24(21)29(20)30(28)34-31/h5-18H,1-4H3/q+1 |
| InChIKey | CCWXORLUADNISV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.17 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|