C10H9N2O2+ — CID 170056225
2-methyl-[1]benzofuro[2,3-d][1,3]oxazol-3-ium-3-amine (PubChem CID 170056225) has the molecular formula C10H9N2O2+ and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-methyl-[1]benzofuro[2,3-d][1,3]oxazol-3-ium-3-amine.
| Compound Name | 2-methyl-[1]benzofuro[2,3-d][1,3]oxazol-3-ium-3-amine |
|---|---|
| PubChem CID | 170056225 |
| Molecular Formula | C10H9N2O2+ |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-methyl-[1]benzofuro[2,3-d][1,3]oxazol-3-ium-3-amine |
| SMILES | Cc1oc2c3ccccc3oc2[n+]1N |
| InChI | InChI=1S/C10H9N2O2/c1-6-12(11)10-9(13-6)7-4-2-3-5-8(7)14-10/h2-5H,11H2,1H3/q+1 |
| InChIKey | HZQWYQKEWFJLOI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|