C16H9IO2 — CID 10642241
2-iodo-6H-indeno[2,1-b]chromen-11-one (PubChem CID 10642241) has the molecular formula C16H9IO2 and a molecular weight of 360.15 g/mol. Its IUPAC name is 2-iodo-6H-indeno[2,1-b]chromen-11-one.
| Compound Name | 2-iodo-6H-indeno[2,1-b]chromen-11-one |
|---|---|
| PubChem CID | 10642241 |
| Molecular Formula | C16H9IO2 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 2-iodo-6H-indeno[2,1-b]chromen-11-one |
| SMILES | O=c1c2c(oc3ccc(I)cc13)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H9IO2/c17-10-5-6-13-12(8-10)16(18)15-11-4-2-1-3-9(11)7-14(15)19-13/h1-6,8H,7H2 |
| InChIKey | WOCXLHZVPVXRCE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|